C40H30Br2N6O3 — CID 136727718
ethyl 2-[10,20-dibromo-15-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136727718) has the molecular formula C40H30Br2N6O3 and a molecular weight of 802.53 g/mol. Its IUPAC name is ethyl 2-[10,20-dibromo-15-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | ethyl 2-[10,20-dibromo-15-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136727718 |
| Molecular Formula | C40H30Br2N6O3 |
| Molecular Weight | 802.53 g/mol |
| Exact Mass | 800.07 |
| IUPAC Name | ethyl 2-[10,20-dibromo-15-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-c1c2nc(c(Br)c3ccc([nH]3)c(-c3cnn(Cc4ccc(OC)cc4)c3)c3nc(c(Br)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C40H30Br2N6O3/c1-3-51-40(49)27-7-5-4-6-26(27)37-30-14-18-34(46-30)38(41)32-16-12-28(44-32)36(29-13-17-33(45-29)39(42)35-19-15-31(37)47-35)24-20-43-48(22-24)21-23-8-10-25(50-2)11-9-23/h4-20,22,44,47H,3,21H2,1-2H3/b36-28-,36-29-,37-30-,37-31-,38-32+,38-34+,39-33+,39-35+ |
| InChIKey | SFJWDBGJGCTQRT-MHMYTBEPSA-N |
| XLogP | 9.94 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.53 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |