C34H24N4O4 — CID 137086267
4-[15-(4-carboxyphenyl)-2,3,21,23-tetrahydroporphyrin-5-yl]benzoic acid (PubChem CID 137086267) has the molecular formula C34H24N4O4 and a molecular weight of 552.59 g/mol. Its IUPAC name is 4-[15-(4-carboxyphenyl)-2,3,21,23-tetrahydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[15-(4-carboxyphenyl)-2,3,21,23-tetrahydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 137086267 |
| Molecular Formula | C34H24N4O4 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 4-[15-(4-carboxyphenyl)-2,3,21,23-tetrahydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccc(C(=O)O)cc4)c4nc(cc5[nH]c2CC5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C34H24N4O4/c39-33(40)21-5-1-19(2-6-21)31-27-13-9-23(35-27)17-25-11-15-29(37-25)32(20-3-7-22(8-4-20)34(41)42)30-16-12-26(38-30)18-24-10-14-28(31)36-24/h1-11,13-15,17-18,35,38H,12,16H2,(H,39,40)(H,41,42)/b25-17-,26-18-,31-28-,32-30- |
| InChIKey | IREBEYCRBFGITC-TYTPWODVSA-N |
| XLogP | 6.89 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |