C54H35N5O2 — CID 137247112
[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl] 4-(prop-2-ynylideneamino)benzoate (PubChem CID 137247112) has the molecular formula C54H35N5O2 and a molecular weight of 785.91 g/mol. Its IUPAC name is [4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl] 4-(prop-2-ynylideneamino)benzoate.
| Compound Name | [4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl] 4-(prop-2-ynylideneamino)benzoate |
|---|---|
| PubChem CID | 137247112 |
| Molecular Formula | C54H35N5O2 |
| Molecular Weight | 785.91 g/mol |
| Exact Mass | 785.28 |
| IUPAC Name | [4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl] 4-(prop-2-ynylideneamino)benzoate |
| SMILES | C#C/C=N/c1ccc(C(=O)Oc2ccc(-c3c4nc(c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c6ccc3[nH]6)C=C5)C=C4)cc2)cc1 |
| InChI | InChI=1S/C54H35N5O2/c1-2-34-55-40-22-18-39(19-23-40)54(60)61-41-24-20-38(21-25-41)53-48-32-30-46(58-48)51(36-14-8-4-9-15-36)44-28-26-42(56-44)50(35-12-6-3-7-13-35)43-27-29-45(57-43)52(37-16-10-5-11-17-37)47-31-33-49(53)59-47/h1,3-34,56,59H/b50-42-,50-43-,51-44-,51-46-,52-45-,52-47-,53-48-,53-49-,55-34+ |
| InChIKey | QJIKJCXTZNFZOW-HMEQWPDSSA-N |
| XLogP | 12.88 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.91 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|