C63H48N4O3 — CID 137136077
[4-[10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] (2R)-2-(3-benzoylphenyl)propanoate (PubChem CID 137136077) has the molecular formula C63H48N4O3 and a molecular weight of 909.10 g/mol. Its IUPAC name is [4-[10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] (2R)-2-(3-benzoylphenyl)propanoate.
| Compound Name | [4-[10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] (2R)-2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 137136077 |
| Molecular Formula | C63H48N4O3 |
| Molecular Weight | 909.10 g/mol |
| Exact Mass | 908.37 |
| IUPAC Name | [4-[10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] (2R)-2-(3-benzoylphenyl)propanoate |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(OC(=O)[C@H](C)c5cccc(C(=O)c6ccccc6)c5)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C63H48N4O3/c1-38-13-19-42(20-14-38)58-50-29-31-52(64-50)59(43-21-15-39(2)16-22-43)54-33-35-56(66-54)61(57-36-34-55(67-57)60(53-32-30-51(58)65-53)44-23-17-40(3)18-24-44)45-25-27-49(28-26-45)70-63(69)41(4)47-11-8-12-48(37-47)62(68)46-9-6-5-7-10-46/h5-37,41,64,67H,1-4H3/b58-50-,58-51-,59-52-,59-54-,60-53-,60-55-,61-56-,61-57-/t41-/m1/s1 |
| InChIKey | WFMSBELAMBQFCK-CQZGKSCYSA-N |
| XLogP | 15.19 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.10 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|