C53H39IN4O10 — CID 135928548
2-[3-[10,15-bis[3-(carboxymethoxy)phenyl]-20-[3-[(E)-3-(123I)iodoprop-2-enoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]acetic acid (PubChem CID 135928548) has the molecular formula C53H39IN4O10 and a molecular weight of 1014.82 g/mol. Its IUPAC name is 2-[3-[10,15-bis[3-(carboxymethoxy)phenyl]-20-[3-[(E)-3-(123I)iodoprop-2-enoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]acetic acid.
| Compound Name | 2-[3-[10,15-bis[3-(carboxymethoxy)phenyl]-20-[3-[(E)-3-(123I)iodoprop-2-enoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 135928548 |
| Molecular Formula | C53H39IN4O10 |
| Molecular Weight | 1014.82 g/mol |
| Exact Mass | 1014.17 |
| IUPAC Name | 2-[3-[10,15-bis[3-(carboxymethoxy)phenyl]-20-[3-[(E)-3-(123I)iodoprop-2-enoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(-c2c3nc(c(-c4cccc(OCC(=O)O)c4)c4ccc([nH]4)c(-c4cccc(OCC(=O)O)c4)c4nc(c(-c5cccc(OC/C=C/[123I])c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C53H39IN4O10/c54-22-5-23-65-35-10-1-6-31(24-35)50-39-14-16-41(55-39)51(32-7-2-11-36(25-32)66-28-47(59)60)43-18-20-45(57-43)53(34-9-4-13-38(27-34)68-30-49(63)64)46-21-19-44(58-46)52(42-17-15-40(50)56-42)33-8-3-12-37(26-33)67-29-48(61)62/h1-22,24-27,55,58H,23,28-30H2,(H,59,60)(H,61,62)(H,63,64)/b22-5+,50-39-,50-40-,51-41-,51-43-,52-42-,52-44-,53-45-,53-46-/i54-4 |
| InChIKey | KJPYPTDIESMKCG-DOMZSSGXSA-N |
| XLogP | 11.04 |
| TPSA | 206.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.82 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|