C51H40N6O — CID 136695206
5-[3-(4-imidazol-1-ylbutoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 136695206) has the molecular formula C51H40N6O and a molecular weight of 752.92 g/mol. Its IUPAC name is 5-[3-(4-imidazol-1-ylbutoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-[3-(4-imidazol-1-ylbutoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136695206 |
| Molecular Formula | C51H40N6O |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.33 |
| IUPAC Name | 5-[3-(4-imidazol-1-ylbutoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3cccc(OCCCCn4ccnc4)c3)c3ccc([nH]3)c2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C51H40N6O/c1-4-13-35(14-5-1)48-40-21-23-42(53-40)49(36-15-6-2-7-16-36)44-25-27-46(55-44)51(38-19-12-20-39(33-38)58-32-11-10-30-57-31-29-52-34-57)47-28-26-45(56-47)50(37-17-8-3-9-18-37)43-24-22-41(48)54-43/h1-9,12-29,31,33-34,53,56H,10-11,30,32H2/b48-40-,48-41-,49-42-,49-44-,50-43-,50-45-,51-46-,51-47- |
| InChIKey | RATGJHGNXMBBGY-PRWUXVGQSA-N |
| XLogP | 12.38 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|