C49H36N6O — CID 136731907
5-[4-(2-imidazol-1-ylethoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 136731907) has the molecular formula C49H36N6O and a molecular weight of 724.87 g/mol. Its IUPAC name is 5-[4-(2-imidazol-1-ylethoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-[4-(2-imidazol-1-ylethoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136731907 |
| Molecular Formula | C49H36N6O |
| Molecular Weight | 724.87 g/mol |
| Exact Mass | 724.30 |
| IUPAC Name | 5-[4-(2-imidazol-1-ylethoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccc(OCCn4ccnc4)cc3)c3ccc([nH]3)c2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C49H36N6O/c1-4-10-33(11-5-1)46-38-20-22-40(51-38)47(34-12-6-2-7-13-34)42-24-26-44(53-42)49(36-16-18-37(19-17-36)56-31-30-55-29-28-50-32-55)45-27-25-43(54-45)48(35-14-8-3-9-15-35)41-23-21-39(46)52-41/h1-29,32,51,54H,30-31H2/b46-38-,46-39-,47-40-,47-42-,48-41-,48-43-,49-44-,49-45- |
| InChIKey | ASHGOHZMGPECGL-VUXQGAMNSA-N |
| XLogP | 11.60 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.87 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |