C56H54N4O12 — CID 136746583
3-[3-[10,15,20-tris[3-(2,3-dihydroxypropoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]propane-1,2-diol (PubChem CID 136746583) has the molecular formula C56H54N4O12 and a molecular weight of 975.06 g/mol. Its IUPAC name is 3-[3-[10,15,20-tris[3-(2,3-dihydroxypropoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[3-[10,15,20-tris[3-(2,3-dihydroxypropoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 136746583 |
| Molecular Formula | C56H54N4O12 |
| Molecular Weight | 975.06 g/mol |
| Exact Mass | 974.37 |
| IUPAC Name | 3-[3-[10,15,20-tris[3-(2,3-dihydroxypropoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]propane-1,2-diol |
| SMILES | OCC(O)COc1cccc(-c2c3nc(c(-c4cccc(OCC(O)CO)c4)c4ccc([nH]4)c(-c4cccc(OCC(O)CO)c4)c4nc(c(-c5cccc(OCC(O)CO)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C56H54N4O12/c61-25-37(65)29-69-41-9-1-5-33(21-41)53-45-13-15-47(57-45)54(34-6-2-10-42(22-34)70-30-38(66)26-62)49-17-19-51(59-49)56(36-8-4-12-44(24-36)72-32-40(68)28-64)52-20-18-50(60-52)55(48-16-14-46(53)58-48)35-7-3-11-43(23-35)71-31-39(67)27-63/h1-24,37-40,57,60-68H,25-32H2/b53-45-,53-46-,54-47-,54-49-,55-48-,55-50-,56-51-,56-52- |
| InChIKey | YVAOGPGEDBECNU-YFLSTINXSA-N |
| XLogP | 6.25 |
| TPSA | 256.12 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 72 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.06 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |