C36H28Br2N4O6 — CID 162517667
1-[3-[10,20-dibromo-15-[3-(1,1-dihydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethane-1,1-diol (PubChem CID 162517667) has the molecular formula C36H28Br2N4O6 and a molecular weight of 772.45 g/mol. Its IUPAC name is 1-[3-[10,20-dibromo-15-[3-(1,1-dihydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethane-1,1-diol.
| Compound Name | 1-[3-[10,20-dibromo-15-[3-(1,1-dihydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 162517667 |
| Molecular Formula | C36H28Br2N4O6 |
| Molecular Weight | 772.45 g/mol |
| Exact Mass | 770.04 |
| IUPAC Name | 1-[3-[10,20-dibromo-15-[3-(1,1-dihydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethane-1,1-diol |
| SMILES | CC(O)(O)Oc1cccc(-c2c3nc(c(Br)c4ccc([nH]4)c(-c4cccc(OC(C)(O)O)c4)c4nc(c(Br)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C36H28Br2N4O6/c1-35(43,44)47-21-7-3-5-19(17-21)31-23-9-13-27(39-23)33(37)29-15-11-25(41-29)32(20-6-4-8-22(18-20)48-36(2,45)46)26-12-16-30(42-26)34(38)28-14-10-24(31)40-28/h3-18,39,42-46H,1-2H3/b31-23-,31-24-,32-25-,32-26-,33-27+,33-29+,34-28+,34-30+ |
| InChIKey | AUAIOXRDCKWSSS-DZXRFRPRSA-N |
| XLogP | 7.59 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.45 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|