C40H36Cl2N4O6 — CID 162517643
1-[3-[10,20-dichloro-15-[3-(1-ethoxy-1-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-1-ethoxyethanol (PubChem CID 162517643) has the molecular formula C40H36Cl2N4O6 and a molecular weight of 739.66 g/mol. Its IUPAC name is 1-[3-[10,20-dichloro-15-[3-(1-ethoxy-1-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-1-ethoxyethanol.
| Compound Name | 1-[3-[10,20-dichloro-15-[3-(1-ethoxy-1-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-1-ethoxyethanol |
|---|---|
| PubChem CID | 162517643 |
| Molecular Formula | C40H36Cl2N4O6 |
| Molecular Weight | 739.66 g/mol |
| Exact Mass | 738.20 |
| IUPAC Name | 1-[3-[10,20-dichloro-15-[3-(1-ethoxy-1-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-1-ethoxyethanol |
| SMILES | CCOC(C)(O)Oc1cccc(-c2c3nc(c(Cl)c4ccc([nH]4)c(-c4cccc(OC(C)(O)OCC)c4)c4nc(c(Cl)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C40H36Cl2N4O6/c1-5-49-39(3,47)51-25-11-7-9-23(21-25)35-27-13-17-31(43-27)37(41)33-19-15-29(45-33)36(24-10-8-12-26(22-24)52-40(4,48)50-6-2)30-16-20-34(46-30)38(42)32-18-14-28(35)44-32/h7-22,43,46-48H,5-6H2,1-4H3/b35-27-,35-28-,36-29-,36-30-,37-31+,37-33+,38-32+,38-34+ |
| InChIKey | BTZOEEQLZAAEKG-SDCNOMAISA-N |
| XLogP | 9.46 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.66 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|