C39H26Cl2N4 — CID 175511184
15,20-dichloro-2-methyl-3,5,10-triphenyl-21,23-dihydroporphyrin (PubChem CID 175511184) has the molecular formula C39H26Cl2N4 and a molecular weight of 621.57 g/mol. Its IUPAC name is 15,20-dichloro-2-methyl-3,5,10-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 15,20-dichloro-2-methyl-3,5,10-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 175511184 |
| Molecular Formula | C39H26Cl2N4 |
| Molecular Weight | 621.57 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | 15,20-dichloro-2-methyl-3,5,10-triphenyl-21,23-dihydroporphyrin |
| SMILES | Cc1c(-c2ccccc2)c2[nH]c1c(Cl)c1nc(c(Cl)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C39H26Cl2N4/c1-23-33(24-11-5-2-6-12-24)39-35(26-15-9-4-10-16-26)29-18-17-27(42-29)34(25-13-7-3-8-14-25)28-19-20-30(43-28)36(40)31-21-22-32(44-31)37(41)38(23)45-39/h2-22,43,45H,1H3/b34-27-,34-28-,35-29-,36-30+,36-31+,37-32+,38-37+,39-35- |
| InChIKey | ATIJYMBCNNCKBQ-ZZROIIEVSA-N |
| XLogP | 11.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.57 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |