C42H40Cl2N4O6 — CID 162517644
1-[3-[10,20-dichloro-15-[3-(1-hydroxy-1-propoxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-1-propoxyethanol (PubChem CID 162517644) has the molecular formula C42H40Cl2N4O6 and a molecular weight of 767.71 g/mol. Its IUPAC name is 1-[3-[10,20-dichloro-15-[3-(1-hydroxy-1-propoxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-1-propoxyethanol.
| Compound Name | 1-[3-[10,20-dichloro-15-[3-(1-hydroxy-1-propoxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-1-propoxyethanol |
|---|---|
| PubChem CID | 162517644 |
| Molecular Formula | C42H40Cl2N4O6 |
| Molecular Weight | 767.71 g/mol |
| Exact Mass | 766.23 |
| IUPAC Name | 1-[3-[10,20-dichloro-15-[3-(1-hydroxy-1-propoxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-1-propoxyethanol |
| SMILES | CCCOC(C)(O)Oc1cccc(-c2c3nc(c(Cl)c4ccc([nH]4)c(-c4cccc(OC(C)(O)OCCC)c4)c4nc(c(Cl)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C42H40Cl2N4O6/c1-5-21-51-41(3,49)53-27-11-7-9-25(23-27)37-29-13-17-33(45-29)39(43)35-19-15-31(47-35)38(26-10-8-12-28(24-26)54-42(4,50)52-22-6-2)32-16-20-36(48-32)40(44)34-18-14-30(37)46-34/h7-20,23-24,45,48-50H,5-6,21-22H2,1-4H3/b37-29-,37-30-,38-31-,38-32-,39-33+,39-35+,40-34+,40-36+ |
| InChIKey | LHSZNQNBIYNUEE-KEDOEWRPSA-N |
| XLogP | 10.24 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.71 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|