C38H24BrN5O3 — CID 135540976
5-bromo-15-(3-nitrophenoxy)-10,20-diphenyl-21,23-dihydroporphyrin (PubChem CID 135540976) has the molecular formula C38H24BrN5O3 and a molecular weight of 678.55 g/mol. Its IUPAC name is 5-bromo-15-(3-nitrophenoxy)-10,20-diphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-bromo-15-(3-nitrophenoxy)-10,20-diphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135540976 |
| Molecular Formula | C38H24BrN5O3 |
| Molecular Weight | 678.55 g/mol |
| Exact Mass | 677.11 |
| IUPAC Name | 5-bromo-15-(3-nitrophenoxy)-10,20-diphenyl-21,23-dihydroporphyrin |
| SMILES | O=[N+]([O-])c1cccc(Oc2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(Br)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C38H24BrN5O3/c39-37-31-18-14-27(40-31)35(23-8-3-1-4-9-23)29-16-20-33(42-29)38(47-26-13-7-12-25(22-26)44(45)46)34-21-17-30(43-34)36(24-10-5-2-6-11-24)28-15-19-32(37)41-28/h1-22,40,43H/b35-27-,35-29-,36-28-,36-30-,37-31+,37-32+,38-33+,38-34+ |
| InChIKey | HOVCNQITUNVOLY-KRYHAOAMSA-N |
| XLogP | 10.45 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.55 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|