2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid

C14H11N3O3 — CID 19821938

IUPAC2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid
SMILESO=C(O)COc1cccc(-c2nc3ncccc3[nH]2)c1
InChIInChI=1S/C14H11N3O3/c18-12(19)8-20-10-4-1-3-9(7-10)13-16-11-5-2-6-15-14(11)17-13/h1-7H,8H2,(H,18,19)(H,15,16,17)
InChIKeySKFPPXAUYHNFNE-UHFFFAOYSA-N
MW269.26 g/mol
LogP2.09
Rot. Bonds4

About 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid

2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid (PubChem CID 19821938) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid
PubChem CID19821938
Molecular FormulaC14H11N3O3
Molecular Weight269.26 g/mol
Exact Mass269.08
IUPAC Name2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid
SMILESO=C(O)COc1cccc(-c2nc3ncccc3[nH]2)c1
InChIInChI=1S/C14H11N3O3/c18-12(19)8-20-10-4-1-3-9(7-10)13-16-11-5-2-6-15-14(11)17-13/h1-7H,8H2,(H,18,19)(H,15,16,17)
InChIKeySKFPPXAUYHNFNE-UHFFFAOYSA-N
XLogP2.09
TPSA88.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.26
LogP ≤ 52.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid?
The IUPAC name of 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid (CID 19821938) is 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid.
What is the SMILES notation for 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid?
The canonical SMILES for 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid is O=C(O)COc1cccc(-c2nc3ncccc3[nH]2)c1.
What is the InChIKey of 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid?
The InChIKey is SKFPPXAUYHNFNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O3/c18-12(19)8-20-10-4-1-3-9(7-10)13-16-11-5-2-6-15-14(11)17-13/h1-7H,8H2,(H,18,19)(H,15,16,17).
What are the key properties of 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid?
2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid has a molecular weight of 269.26 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]acetic acid is sourced from PubChem (CID 19821938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).