C27H23N3O2 — CID 59243231
2-[3-(2-phenylethoxy)-5-phenylmethoxyphenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 59243231) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[3-(2-phenylethoxy)-5-phenylmethoxyphenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[3-(2-phenylethoxy)-5-phenylmethoxyphenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 59243231 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[3-(2-phenylethoxy)-5-phenylmethoxyphenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | c1ccc(CCOc2cc(OCc3ccccc3)cc(-c3nc4ncccc4[nH]3)c2)cc1 |
| InChI | InChI=1S/C27H23N3O2/c1-3-8-20(9-4-1)13-15-31-23-16-22(26-29-25-12-7-14-28-27(25)30-26)17-24(18-23)32-19-21-10-5-2-6-11-21/h1-12,14,16-18H,13,15,19H2,(H,28,29,30) |
| InChIKey | KYEDBVFOGHKHAY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |