C23H24N4O3 — CID 67489922
4-[[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-[(2S)-1-methoxypropan-2-yl]oxyphenoxy]methyl]aniline (PubChem CID 67489922) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-[(2S)-1-methoxypropan-2-yl]oxyphenoxy]methyl]aniline.
| Compound Name | 4-[[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-[(2S)-1-methoxypropan-2-yl]oxyphenoxy]methyl]aniline |
|---|---|
| PubChem CID | 67489922 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-[[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-[(2S)-1-methoxypropan-2-yl]oxyphenoxy]methyl]aniline |
| SMILES | COC[C@H](C)Oc1cc(OCc2ccc(N)cc2)cc(-c2nc3ncccc3[nH]2)c1 |
| InChI | InChI=1S/C23H24N4O3/c1-15(13-28-2)30-20-11-17(22-26-21-4-3-9-25-23(21)27-22)10-19(12-20)29-14-16-5-7-18(24)8-6-16/h3-12,15H,13-14,24H2,1-2H3,(H,25,26,27)/t15-/m0/s1 |
| InChIKey | HXNFXLDHYFBWQU-HNNXBMFYSA-N |
| XLogP | 4.20 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|