About 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine
4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine (PubChem CID 59243024) has the molecular formula C21H26N4O3
and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine |
| PubChem CID | 59243024 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine |
| SMILES | CC(C)Oc1cc(OCCN2CCOCC2)cc(-c2nc3ncccc3[nH]2)c1 |
| InChI | InChI=1S/C21H26N4O3/c1-15(2)28-18-13-16(20-23-19-4-3-5-22-21(19)24-20)12-17(14-18)27-11-8-25-6-9-26-10-7-25/h3-5,12-15H,6-11H2,1-2H3,(H,22,23,24) |
| InChIKey | QPKJHMCKTCZHOQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine?
The IUPAC name of 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine (CID 59243024) is 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine.
What is the SMILES notation for 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine?
The canonical SMILES for 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine is CC(C)Oc1cc(OCCN2CCOCC2)cc(-c2nc3ncccc3[nH]2)c1.
What is the InChIKey of 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine?
The InChIKey is QPKJHMCKTCZHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O3/c1-15(2)28-18-13-16(20-23-19-4-3-5-22-21(19)24-20)12-17(14-18)27-11-8-25-6-9-26-10-7-25/h3-5,12-15H,6-11H2,1-2H3,(H,22,23,24).
What are the key properties of 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine?
4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine has a molecular weight of 382.46 g/mol, XLogP of 3.12, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[3-(1H-imidazo[4,5-b]pyridin-2-yl)-5-propan-2-yloxyphenoxy]ethyl]morpholine is sourced from PubChem (CID 59243024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).