C20H22N4O4 — CID 122690240
N-hydroxy-2-[4-(2-morpholin-4-ylethoxy)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 122690240) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-hydroxy-2-[4-(2-morpholin-4-ylethoxy)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-hydroxy-2-[4-(2-morpholin-4-ylethoxy)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 122690240 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-hydroxy-2-[4-(2-morpholin-4-ylethoxy)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2nc(-c3ccc(OCCN4CCOCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H22N4O4/c25-20(23-26)15-3-6-17-18(13-15)22-19(21-17)14-1-4-16(5-2-14)28-12-9-24-7-10-27-11-8-24/h1-6,13,26H,7-12H2,(H,21,22)(H,23,25) |
| InChIKey | CQBOJWAVNFCIJR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|