C25H25N3O6 — CID 11669849
N-[3-[4-(hydroxycarbamoyl)phenyl]prop-2-ynyl]-5-(2-morpholin-4-ylethoxy)-1-benzofuran-2-carboxamide (PubChem CID 11669849) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is N-[3-[4-(hydroxycarbamoyl)phenyl]prop-2-ynyl]-5-(2-morpholin-4-ylethoxy)-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[4-(hydroxycarbamoyl)phenyl]prop-2-ynyl]-5-(2-morpholin-4-ylethoxy)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 11669849 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[3-[4-(hydroxycarbamoyl)phenyl]prop-2-ynyl]-5-(2-morpholin-4-ylethoxy)-1-benzofuran-2-carboxamide |
| SMILES | O=C(NO)c1ccc(C#CCNC(=O)c2cc3cc(OCCN4CCOCC4)ccc3o2)cc1 |
| InChI | InChI=1S/C25H25N3O6/c29-24(27-31)19-5-3-18(4-6-19)2-1-9-26-25(30)23-17-20-16-21(7-8-22(20)34-23)33-15-12-28-10-13-32-14-11-28/h3-8,16-17,31H,9-15H2,(H,26,30)(H,27,29) |
| InChIKey | BSQJCAVAFBXTRC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|