C26H31N3O6 — CID 87108915
N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-5-(2-pyrrolidin-1-ylethoxy)-1-benzofuran-2-carboxamide (PubChem CID 87108915) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-5-(2-pyrrolidin-1-ylethoxy)-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-5-(2-pyrrolidin-1-ylethoxy)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 87108915 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-5-(2-pyrrolidin-1-ylethoxy)-1-benzofuran-2-carboxamide |
| SMILES | CCCC(NC(=O)c1cc2cc(OCCN3CCCC3)ccc2o1)Oc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C26H31N3O6/c1-2-5-24(34-20-8-6-18(7-9-20)25(30)28-32)27-26(31)23-17-19-16-21(10-11-22(19)35-23)33-15-14-29-12-3-4-13-29/h6-11,16-17,24,32H,2-5,12-15H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | LIZSPYYFJSVHQJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|