C24H28N2O7 — CID 87108504
N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-3-(2-methoxyethoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 87108504) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-3-(2-methoxyethoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-3-(2-methoxyethoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 87108504 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-3-(2-methoxyethoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | CCCC(NC(=O)c1oc2ccccc2c1COCCOC)Oc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C24H28N2O7/c1-3-6-21(32-17-11-9-16(10-12-17)23(27)26-29)25-24(28)22-19(15-31-14-13-30-2)18-7-4-5-8-20(18)33-22/h4-5,7-12,21,29H,3,6,13-15H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | BZFYJEDWEUQBCD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 119.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|