C20H23N3O4 — CID 87107929
N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-2,3-dihydro-1H-isoindole-1-carboxamide (PubChem CID 87107929) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-2,3-dihydro-1H-isoindole-1-carboxamide.
| Compound Name | N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-2,3-dihydro-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 87107929 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[1-[4-(hydroxycarbamoyl)phenoxy]butyl]-2,3-dihydro-1H-isoindole-1-carboxamide |
| SMILES | CCCC(NC(=O)C1NCc2ccccc21)Oc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-2-5-17(27-15-10-8-13(9-11-15)19(24)23-26)22-20(25)18-16-7-4-3-6-14(16)12-21-18/h3-4,6-11,17-18,21,26H,2,5,12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | DRARRUYDQUVNTM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|