C53H39N5O4 — CID 10941919
dimethyl 1-methyl-2-(5,10,15,20-tetraphenyl-21,22-dihydroporphyrin-2-yl)pyrrole-3,4-dicarboxylate (PubChem CID 10941919) has the molecular formula C53H39N5O4 and a molecular weight of 809.93 g/mol. Its IUPAC name is dimethyl 1-methyl-2-(5,10,15,20-tetraphenyl-21,22-dihydroporphyrin-2-yl)pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-methyl-2-(5,10,15,20-tetraphenyl-21,22-dihydroporphyrin-2-yl)pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10941919 |
| Molecular Formula | C53H39N5O4 |
| Molecular Weight | 809.93 g/mol |
| Exact Mass | 809.30 |
| IUPAC Name | dimethyl 1-methyl-2-(5,10,15,20-tetraphenyl-21,22-dihydroporphyrin-2-yl)pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)c1cn(C)c(-c2cc3[nH]c2c(-c2ccccc2)c2nc(c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc([nH]5)c3-c3ccccc3)C=C4)C=C2)c1C(=O)OC |
| InChI | InChI=1S/C53H39N5O4/c1-58-31-37(52(59)61-2)49(53(60)62-3)51(58)36-30-44-47(34-20-12-6-13-21-34)42-27-26-40(55-42)45(32-16-8-4-9-17-32)38-24-25-39(54-38)46(33-18-10-5-11-19-33)41-28-29-43(56-41)48(50(36)57-44)35-22-14-7-15-23-35/h4-31,55,57H,1-3H3/b45-38-,45-40-,46-39-,46-41-,47-42-,47-44-,48-43-,50-48- |
| InChIKey | SJMBPBTVAYEUKB-NNTBCBNNSA-N |
| XLogP | 11.90 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.93 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |