C52H40N4O3 — CID 89408604
2,3-diethynyl-5-(3-methoxyphenyl)-10,15,20-tris(3-methylphenyl)-22,24-dihydroporphyrin-2,3-diol (PubChem CID 89408604) has the molecular formula C52H40N4O3 and a molecular weight of 768.92 g/mol. Its IUPAC name is 2,3-diethynyl-5-(3-methoxyphenyl)-10,15,20-tris(3-methylphenyl)-22,24-dihydroporphyrin-2,3-diol.
| Compound Name | 2,3-diethynyl-5-(3-methoxyphenyl)-10,15,20-tris(3-methylphenyl)-22,24-dihydroporphyrin-2,3-diol |
|---|---|
| PubChem CID | 89408604 |
| Molecular Formula | C52H40N4O3 |
| Molecular Weight | 768.92 g/mol |
| Exact Mass | 768.31 |
| IUPAC Name | 2,3-diethynyl-5-(3-methoxyphenyl)-10,15,20-tris(3-methylphenyl)-22,24-dihydroporphyrin-2,3-diol |
| SMILES | C#CC1(O)c2nc(c(-c3cccc(OC)c3)c3ccc([nH]3)c(-c3cccc(C)c3)c3nc(c(-c4cccc(C)c4)c4ccc([nH]4)c2-c2cccc(C)c2)C=C3)C1(O)C#C |
| InChI | InChI=1S/C52H40N4O3/c1-7-51(57)49-47(36-18-11-15-33(5)29-36)43-25-23-41(54-43)45(34-16-9-13-31(3)27-34)39-21-22-40(53-39)46(35-17-10-14-32(4)28-35)42-24-26-44(55-42)48(50(56-49)52(51,58)8-2)37-19-12-20-38(30-37)59-6/h1-2,9-30,54-55,57-58H,3-6H3/b45-39-,45-41-,46-40-,46-42-,47-43-,48-44-,49-47-,50-48- |
| InChIKey | MOWVPQQUKDJCSF-OVWLOWEBSA-N |
| XLogP | 10.43 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.92 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|