C44H26Cl4N6O2 — CID 136798507
5,10,15,20-tetrakis(3-chlorophenyl)-3-nitro-21,23-dihydroporphyrin-2-amine (PubChem CID 136798507) has the molecular formula C44H26Cl4N6O2 and a molecular weight of 812.54 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3-chlorophenyl)-3-nitro-21,23-dihydroporphyrin-2-amine.
| Compound Name | 5,10,15,20-tetrakis(3-chlorophenyl)-3-nitro-21,23-dihydroporphyrin-2-amine |
|---|---|
| PubChem CID | 136798507 |
| Molecular Formula | C44H26Cl4N6O2 |
| Molecular Weight | 812.54 g/mol |
| Exact Mass | 810.09 |
| IUPAC Name | 5,10,15,20-tetrakis(3-chlorophenyl)-3-nitro-21,23-dihydroporphyrin-2-amine |
| SMILES | Nc1c([N+](=O)[O-])c2[nH]c1c(-c1cccc(Cl)c1)c1nc(c(-c3cccc(Cl)c3)c3ccc([nH]3)c(-c3cccc(Cl)c3)c3nc(c2-c2cccc(Cl)c2)C=C3)C=C1 |
| InChI | InChI=1S/C44H26Cl4N6O2/c45-27-9-1-5-23(19-27)37-31-13-14-32(50-31)38(24-6-2-10-28(46)20-24)34-16-18-36(52-34)40(26-8-4-12-30(48)22-26)43-44(54(55)56)41(49)42(53-43)39(35-17-15-33(37)51-35)25-7-3-11-29(47)21-25/h1-22,50,53H,49H2/b37-31-,37-33-,38-32-,38-34-,39-35-,40-36-,42-39-,43-40- |
| InChIKey | DBIHXOQKZSUKIW-STFPZJOASA-N |
| XLogP | 13.43 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.54 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|