C44H48N6 — CID 136682566
3-[15-(3-aminophenyl)-10,20-di(hexan-2-yl)-21,23-dihydroporphyrin-5-yl]aniline (PubChem CID 136682566) has the molecular formula C44H48N6 and a molecular weight of 660.91 g/mol. Its IUPAC name is 3-[15-(3-aminophenyl)-10,20-di(hexan-2-yl)-21,23-dihydroporphyrin-5-yl]aniline.
| Compound Name | 3-[15-(3-aminophenyl)-10,20-di(hexan-2-yl)-21,23-dihydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 136682566 |
| Molecular Formula | C44H48N6 |
| Molecular Weight | 660.91 g/mol |
| Exact Mass | 660.39 |
| IUPAC Name | 3-[15-(3-aminophenyl)-10,20-di(hexan-2-yl)-21,23-dihydroporphyrin-5-yl]aniline |
| SMILES | CCCCC(C)c1c2nc(c(-c3cccc(N)c3)c3ccc([nH]3)c(C(C)CCCC)c3nc(c(-c4cccc(N)c4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C44H48N6/c1-5-7-11-27(3)41-33-17-21-37(47-33)43(29-13-9-15-31(45)25-29)39-23-19-35(49-39)42(28(4)12-8-6-2)36-20-24-40(50-36)44(38-22-18-34(41)48-38)30-14-10-16-32(46)26-30/h9-10,13-28,47,50H,5-8,11-12,45-46H2,1-4H3/b41-33-,41-34-,42-35-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | VLDHQFFVQPPRIL-VRDUDMDPSA-N |
| XLogP | 11.74 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.91 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|