C49H39BrN4O — CID 141235015
5-[4-(1-bromopentoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 141235015) has the molecular formula C49H39BrN4O and a molecular weight of 779.78 g/mol. Its IUPAC name is 5-[4-(1-bromopentoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-[4-(1-bromopentoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 141235015 |
| Molecular Formula | C49H39BrN4O |
| Molecular Weight | 779.78 g/mol |
| Exact Mass | 778.23 |
| IUPAC Name | 5-[4-(1-bromopentoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | CCCCC(Br)Oc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C49H39BrN4O/c1-2-3-19-45(50)55-36-22-20-35(21-23-36)49-43-30-28-41(53-43)47(33-15-9-5-10-16-33)39-26-24-37(51-39)46(32-13-7-4-8-14-32)38-25-27-40(52-38)48(34-17-11-6-12-18-34)42-29-31-44(49)54-42/h4-18,20-31,45,51,54H,2-3,19H2,1H3/b46-37-,46-38-,47-39-,47-41-,48-40-,48-42-,49-43-,49-44- |
| InChIKey | JAHMLSQBSXYHEA-NNOJJDTRSA-N |
| XLogP | 13.61 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.78 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|