C51H40F4N4O6 — CID 137229930
3-[10,20-bis(3-hydroxyphenyl)-15-[2,3,5,6-tetrafluoro-4-[3-(1-hydroxypropoxy)-2-methylpropoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 137229930) has the molecular formula C51H40F4N4O6 and a molecular weight of 880.90 g/mol. Its IUPAC name is 3-[10,20-bis(3-hydroxyphenyl)-15-[2,3,5,6-tetrafluoro-4-[3-(1-hydroxypropoxy)-2-methylpropoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 3-[10,20-bis(3-hydroxyphenyl)-15-[2,3,5,6-tetrafluoro-4-[3-(1-hydroxypropoxy)-2-methylpropoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 137229930 |
| Molecular Formula | C51H40F4N4O6 |
| Molecular Weight | 880.90 g/mol |
| Exact Mass | 880.29 |
| IUPAC Name | 3-[10,20-bis(3-hydroxyphenyl)-15-[2,3,5,6-tetrafluoro-4-[3-(1-hydroxypropoxy)-2-methylpropoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | CCC(O)OCC(C)COc1c(F)c(F)c(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4cccc(O)c4)c4nc(c(-c5cccc(O)c5)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C51H40F4N4O6/c1-3-41(63)64-24-26(2)25-65-51-49(54)47(52)46(48(53)50(51)55)45-39-19-17-37(58-39)43(28-8-5-11-31(61)22-28)35-15-13-33(56-35)42(27-7-4-10-30(60)21-27)34-14-16-36(57-34)44(38-18-20-40(45)59-38)29-9-6-12-32(62)23-29/h4-23,26,41,56,59-63H,3,24-25H2,1-2H3/b42-33-,42-34-,43-35-,43-37-,44-36-,44-38-,45-39+,45-40+ |
| InChIKey | YMPTWTNSTFQIAL-BWDAPIQXSA-N |
| XLogP | 11.76 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.90 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|