About 1-methoxypyridin-1-ium hexafluorophosphate
1-methoxypyridin-1-ium hexafluorophosphate (PubChem CID 21217332) has the molecular formula C6H8F6NOP
and a molecular weight of 255.10 g/mol. Its IUPAC name is 1-methoxypyridin-1-ium hexafluorophosphate.
Molecular Properties
| Compound Name | 1-methoxypyridin-1-ium hexafluorophosphate |
| PubChem CID | 21217332 |
| Molecular Formula | C6H8F6NOP |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 1-methoxypyridin-1-ium hexafluorophosphate |
| SMILES | CO[n+]1ccccc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C6H8NO.F6P/c1-8-7-5-3-2-4-6-7;1-7(2,3,4,5)6/h2-6H,1H3;/q+1;-1 |
| InChIKey | RYHTUUMBTIPLNB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypyridin-1-ium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypyridin-1-ium hexafluorophosphate?
The IUPAC name of 1-methoxypyridin-1-ium hexafluorophosphate (CID 21217332) is 1-methoxypyridin-1-ium hexafluorophosphate.
What is the SMILES notation for 1-methoxypyridin-1-ium hexafluorophosphate?
The canonical SMILES for 1-methoxypyridin-1-ium hexafluorophosphate is CO[n+]1ccccc1.F[P-](F)(F)(F)(F)F.
What is the InChIKey of 1-methoxypyridin-1-ium hexafluorophosphate?
The InChIKey is RYHTUUMBTIPLNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NO.F6P/c1-8-7-5-3-2-4-6-7;1-7(2,3,4,5)6/h2-6H,1H3;/q+1;-1.
What are the key properties of 1-methoxypyridin-1-ium hexafluorophosphate?
1-methoxypyridin-1-ium hexafluorophosphate has a molecular weight of 255.10 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypyridin-1-ium hexafluorophosphate is sourced from PubChem (CID 21217332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).