About ruthenium dihexafluorophosphate
ruthenium dihexafluorophosphate (PubChem CID 175472696) has the molecular formula F12P2Ru-2
and a molecular weight of 390.99 g/mol. Its IUPAC name is ruthenium dihexafluorophosphate.
Molecular Properties
| Compound Name | ruthenium dihexafluorophosphate |
| PubChem CID | 175472696 |
| Molecular Formula | F12P2Ru-2 |
| Molecular Weight | 390.99 g/mol |
| Exact Mass | 391.83 |
| IUPAC Name | ruthenium dihexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.[Ru] |
| InChI | InChI=1S/2F6P.Ru/c2*1-7(2,3,4,5)6;/q2*-1; |
| InChIKey | ADBCEIXYQWKBGM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.99 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ruthenium dihexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium dihexafluorophosphate?
The IUPAC name of ruthenium dihexafluorophosphate (CID 175472696) is ruthenium dihexafluorophosphate.
What is the SMILES notation for ruthenium dihexafluorophosphate?
The canonical SMILES for ruthenium dihexafluorophosphate is F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.[Ru].
What is the InChIKey of ruthenium dihexafluorophosphate?
The InChIKey is ADBCEIXYQWKBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/2F6P.Ru/c2*1-7(2,3,4,5)6;/q2*-1;.
What are the key properties of ruthenium dihexafluorophosphate?
ruthenium dihexafluorophosphate has a molecular weight of 390.99 g/mol, XLogP of 6.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium dihexafluorophosphate is sourced from PubChem (CID 175472696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).