C36H26BF10N — CID 22370886
bis(4-ethenylphenyl)-bis(2,3,4,5,6-pentafluorophenyl)boranuide;dimethyl(phenyl)azanium (PubChem CID 22370886) has the molecular formula C36H26BF10N and a molecular weight of 673.40 g/mol. Its IUPAC name is bis(4-ethenylphenyl)-bis(2,3,4,5,6-pentafluorophenyl)boranuide;dimethyl(phenyl)azanium.
| Compound Name | bis(4-ethenylphenyl)-bis(2,3,4,5,6-pentafluorophenyl)boranuide;dimethyl(phenyl)azanium |
|---|---|
| PubChem CID | 22370886 |
| Molecular Formula | C36H26BF10N |
| Molecular Weight | 673.40 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | bis(4-ethenylphenyl)-bis(2,3,4,5,6-pentafluorophenyl)boranuide;dimethyl(phenyl)azanium |
| SMILES | C=Cc1ccc([B-](c2ccc(C=C)cc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1.C[NH+](C)c1ccccc1 |
| InChI | InChI=1S/C28H14BF10.C8H11N/c1-3-13-5-9-15(10-6-13)29(16-11-7-14(4-2)8-12-16,17-19(30)23(34)27(38)24(35)20(17)31)18-21(32)25(36)28(39)26(37)22(18)33;1-9(2)8-6-4-3-5-7-8/h3-12H,1-2H2;3-7H,1-2H3/q-1;/p+1 |
| InChIKey | NYTXKSVJNUACJE-UHFFFAOYSA-O |
| XLogP | 6.20 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|