C35H21BF15N — CID 139690846
dimethyl(phenyl)azanium;tris(2,3,4,5,6-pentafluorophenyl)-(4-prop-2-enylphenyl)boranuide (PubChem CID 139690846) has the molecular formula C35H21BF15N and a molecular weight of 751.34 g/mol. Its IUPAC name is dimethyl(phenyl)azanium;tris(2,3,4,5,6-pentafluorophenyl)-(4-prop-2-enylphenyl)boranuide.
| Compound Name | dimethyl(phenyl)azanium;tris(2,3,4,5,6-pentafluorophenyl)-(4-prop-2-enylphenyl)boranuide |
|---|---|
| PubChem CID | 139690846 |
| Molecular Formula | C35H21BF15N |
| Molecular Weight | 751.34 g/mol |
| Exact Mass | 751.15 |
| IUPAC Name | dimethyl(phenyl)azanium;tris(2,3,4,5,6-pentafluorophenyl)-(4-prop-2-enylphenyl)boranuide |
| SMILES | C=CCc1ccc([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1.C[NH+](C)c1ccccc1 |
| InChI | InChI=1S/C27H9BF15.C8H11N/c1-2-3-8-4-6-9(7-5-8)28(10-13(29)19(35)25(41)20(36)14(10)30,11-15(31)21(37)26(42)22(38)16(11)32)12-17(33)23(39)27(43)24(40)18(12)34;1-9(2)8-6-4-3-5-7-8/h2,4-7H,1,3H2;3-7H,1-2H3/q-1;/p+1 |
| InChIKey | QJFJUZTYGMBSBS-UHFFFAOYSA-O |
| XLogP | 6.34 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|