C33H17BF19NOSi — CID 173197853
dimethyl(phenyl)azanium;tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methoxysilylphenyl)boranuide (PubChem CID 173197853) has the molecular formula C33H17BF19NOSi and a molecular weight of 843.36 g/mol. Its IUPAC name is dimethyl(phenyl)azanium;tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methoxysilylphenyl)boranuide.
| Compound Name | dimethyl(phenyl)azanium;tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methoxysilylphenyl)boranuide |
|---|---|
| PubChem CID | 173197853 |
| Molecular Formula | C33H17BF19NOSi |
| Molecular Weight | 843.36 g/mol |
| Exact Mass | 843.09 |
| IUPAC Name | dimethyl(phenyl)azanium;tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methoxysilylphenyl)boranuide |
| SMILES | CO[SiH2]c1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.C[NH+](C)c1ccccc1 |
| InChI | InChI=1S/C25H5BF19OSi.C8H11N/c1-46-47-25-23(44)12(33)5(13(34)24(25)45)26(2-6(27)14(35)20(41)15(36)7(2)28,3-8(29)16(37)21(42)17(38)9(3)30)4-10(31)18(39)22(43)19(40)11(4)32;1-9(2)8-6-4-3-5-7-8/h47H2,1H3;3-7H,1-2H3/q-1;/p+1 |
| InChIKey | LLTDQKLNTDAPTN-UHFFFAOYSA-O |
| XLogP | 4.53 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|