C27H24BF4O3Si- — CID 139766289
triphenyl-(2,3,5,6-tetrafluoro-4-trimethoxysilylphenyl)boranuide (PubChem CID 139766289) has the molecular formula C27H24BF4O3Si- and a molecular weight of 511.38 g/mol. Its IUPAC name is triphenyl-(2,3,5,6-tetrafluoro-4-trimethoxysilylphenyl)boranuide.
| Compound Name | triphenyl-(2,3,5,6-tetrafluoro-4-trimethoxysilylphenyl)boranuide |
|---|---|
| PubChem CID | 139766289 |
| Molecular Formula | C27H24BF4O3Si- |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | triphenyl-(2,3,5,6-tetrafluoro-4-trimethoxysilylphenyl)boranuide |
| SMILES | CO[Si](OC)(OC)c1c(F)c(F)c([B-](c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C27H24BF4O3Si/c1-33-36(34-2,35-3)27-25(31)23(29)22(24(30)26(27)32)28(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3/q-1 |
| InChIKey | DDLGSJUQEGUZLG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|