C46H24BF19O3Si — CID 139766393
[cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-trimethoxysilylphenyl)boranuide (PubChem CID 139766393) has the molecular formula C46H24BF19O3Si and a molecular weight of 1024.55 g/mol. Its IUPAC name is [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-trimethoxysilylphenyl)boranuide.
| Compound Name | [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-trimethoxysilylphenyl)boranuide |
|---|---|
| PubChem CID | 139766393 |
| Molecular Formula | C46H24BF19O3Si |
| Molecular Weight | 1024.55 g/mol |
| Exact Mass | 1024.13 |
| IUPAC Name | [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-trimethoxysilylphenyl)boranuide |
| SMILES | C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.CO[Si](OC)(OC)c1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C27H9BF19O3Si.C19H15/c1-48-51(49-2,50-3)27-25(46)14(35)7(15(36)26(27)47)28(4-8(29)16(37)22(43)17(38)9(4)30,5-10(31)18(39)23(44)19(40)11(5)32)6-12(33)20(41)24(45)21(42)13(6)34;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-3H3;1-15H/q-1;+1 |
| InChIKey | NMKPBFQGXQUHMT-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.55 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|