About bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate
bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate (PubChem CID 157175757) has the molecular formula C39H30O3
and a molecular weight of 546.67 g/mol. Its IUPAC name is bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate.
Molecular Properties
| Compound Name | bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate |
| PubChem CID | 157175757 |
| Molecular Formula | C39H30O3 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate |
| SMILES | C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.O=C([O-])[O-] |
| InChI | InChI=1S/2C19H15.CH2O3/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3)4/h2*1-15H;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | ANZDXJKPGGRXNN-UHFFFAOYSA-L |
| XLogP | 7.19 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate?
The IUPAC name of bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate (CID 157175757) is bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate.
What is the SMILES notation for bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate?
The canonical SMILES for bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate is C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.O=C([O-])[O-].
What is the InChIKey of bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate?
The InChIKey is ANZDXJKPGGRXNN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C19H15.CH2O3/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3)4/h2*1-15H;(H2,2,3,4)/q2*+1;/p-2.
What are the key properties of bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate?
bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate has a molecular weight of 546.67 g/mol, XLogP of 7.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis([cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene);carbonate is sourced from PubChem (CID 157175757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).