About CID 139104503
CID 139104503 (PubChem CID 139104503) has the molecular formula C50H17B2Cl2F20N3
and a molecular weight of 1132.20 g/mol.
Molecular Properties
| Compound Name | CID 139104503 |
| PubChem CID | 139104503 |
| Molecular Formula | C50H17B2Cl2F20N3 |
| Molecular Weight | 1132.20 g/mol |
| Exact Mass | 1131.07 |
| IUPAC Name | — |
| SMILES | C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.ClCCl.N#[N+]N1[B-]2(c3c(F)c(F)c(F)c(F)c3-c3c(F)c(F)c(F)c(F)c32)c2c(F)c(F)c(F)c(F)c2[B-]12c1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C30B2F20N3.C19H15.CH2Cl2/c33-11-1-2-6(16(38)26(48)22(44)12(2)34)31(5(1)15(37)25(47)21(11)43)9-10(20(42)30(52)29(51)19(9)41)32(55(31)54-53)7-3(13(35)23(45)27(49)17(7)39)4-8(32)18(40)28(50)24(46)14(4)36;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1-3/h;1-15H;1H2/q-1;+1; |
| InChIKey | PROKMCJANQSYTE-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 77 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1132.20 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze CID 139104503 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139104503?
The IUPAC name of CID 139104503 (CID 139104503) is not available.
What is the SMILES notation for CID 139104503?
The canonical SMILES for CID 139104503 is C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.ClCCl.N#[N+]N1[B-]2(c3c(F)c(F)c(F)c(F)c3-c3c(F)c(F)c(F)c(F)c32)c2c(F)c(F)c(F)c(F)c2[B-]12c1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c12.
What is the InChIKey of CID 139104503?
The InChIKey is PROKMCJANQSYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C30B2F20N3.C19H15.CH2Cl2/c33-11-1-2-6(16(38)26(48)22(44)12(2)34)31(5(1)15(37)25(47)21(11)43)9-10(20(42)30(52)29(51)19(9)41)32(55(31)54-53)7-3(13(35)23(45)27(49)17(7)39)4-8(32)18(40)28(50)24(46)14(4)36;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1-3/h;1-15H;1H2/q-1;+1;.
What are the key properties of CID 139104503?
CID 139104503 has a molecular weight of 1132.20 g/mol, XLogP of 11.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139104503 is sourced from PubChem (CID 139104503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).