C27H23BF12 — CID 139978314
[cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tetrakis(1,2,2-trifluoroethyl)boranuide (PubChem CID 139978314) has the molecular formula C27H23BF12 and a molecular weight of 586.27 g/mol. Its IUPAC name is [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tetrakis(1,2,2-trifluoroethyl)boranuide.
| Compound Name | [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tetrakis(1,2,2-trifluoroethyl)boranuide |
|---|---|
| PubChem CID | 139978314 |
| Molecular Formula | C27H23BF12 |
| Molecular Weight | 586.27 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tetrakis(1,2,2-trifluoroethyl)boranuide |
| SMILES | C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.FC(F)C(F)[B-](C(F)C(F)F)(C(F)C(F)F)C(F)C(F)F |
| InChI | InChI=1S/C19H15.C8H8BF12/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;10-1(5(14)15)9(2(11)6(16)17,3(12)7(18)19)4(13)8(20)21/h1-15H;1-8H/q+1;-1 |
| InChIKey | MFSZUZKKBHXFAZ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.27 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|