C19H13W+ — CID 155768050
[(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tungsten(2+) (PubChem CID 155768050) has the molecular formula C19H13W+ and a molecular weight of 425.15 g/mol. Its IUPAC name is [(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tungsten(2+).
| Compound Name | [(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tungsten(2+) |
|---|---|
| PubChem CID | 155768050 |
| Molecular Formula | C19H13W+ |
| Molecular Weight | 425.15 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | [(E)-cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;tungsten(2+) |
| SMILES | [C-]1=CC=C[CH+]/C1=C(/c1[c-]cccc1)c1ccccc1.[W+2] |
| InChI | InChI=1S/C19H13.W/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-12,14H;/q-1;+2/b19-17-; |
| InChIKey | RFSZPJVWIHYGOJ-HGMLFDQWSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.15 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|