C30H34Zr+2 — CID 23229363
bis(cyclopentane);1,2-diphenylethenylbenzene;zirconium(4+) (PubChem CID 23229363) has the molecular formula C30H34Zr+2 and a molecular weight of 485.83 g/mol. Its IUPAC name is bis(cyclopentane);1,2-diphenylethenylbenzene;zirconium(4+).
| Compound Name | bis(cyclopentane);1,2-diphenylethenylbenzene;zirconium(4+) |
|---|---|
| PubChem CID | 23229363 |
| Molecular Formula | C30H34Zr+2 |
| Molecular Weight | 485.83 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | bis(cyclopentane);1,2-diphenylethenylbenzene;zirconium(4+) |
| SMILES | C1CCCC1.C1CCCC1.[C-](=C(/c1[c-]cccc1)c1ccccc1)\c1ccccc1.[Zr+4] |
| InChI | InChI=1S/C20H14.2C5H10.Zr/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;2*1-2-4-5-3-1;/h1-14H;2*1-5H2;/q-2;;;+4 |
| InChIKey | JWBLRNLDQTZSHK-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.83 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|