About 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium
1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium (PubChem CID 58787392) has the molecular formula C15H11V5Y-3
and a molecular weight of 534.88 g/mol. Its IUPAC name is 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium.
Molecular Properties
| Compound Name | 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium |
| PubChem CID | 58787392 |
| Molecular Formula | C15H11V5Y-3 |
| Molecular Weight | 534.88 g/mol |
| Exact Mass | 534.71 |
| IUPAC Name | 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium |
| SMILES | [CH2-]/C(=[C-]\c1ccccc1)c1[c-]cccc1.[V].[V].[V].[V].[V].[Y] |
| InChI | InChI=1S/C15H11.5V.Y/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14;;;;;;/h2-10H,1H2;;;;;;/q-3;;;;;; |
| InChIKey | OPVGNQQIKMMMHI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.88 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium?
The IUPAC name of 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium (CID 58787392) is 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium.
What is the SMILES notation for 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium?
The canonical SMILES for 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium is [CH2-]/C(=[C-]\c1ccccc1)c1[c-]cccc1.[V].[V].[V].[V].[V].[Y].
What is the InChIKey of 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium?
The InChIKey is OPVGNQQIKMMMHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11.5V.Y/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14;;;;;;/h2-10H,1H2;;;;;;/q-3;;;;;;.
What are the key properties of 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium?
1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium has a molecular weight of 534.88 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylprop-1-en-2-ylbenzene;pentakis(vanadium);yttrium is sourced from PubChem (CID 58787392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).