About ethane;N-methanidylaniline;yttrium
ethane;N-methanidylaniline;yttrium (PubChem CID 161273901) has the molecular formula C9H13NY-2
and a molecular weight of 224.12 g/mol. Its IUPAC name is ethane;N-methanidylaniline;yttrium.
Molecular Properties
| Compound Name | ethane;N-methanidylaniline;yttrium |
| PubChem CID | 161273901 |
| Molecular Formula | C9H13NY-2 |
| Molecular Weight | 224.12 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | ethane;N-methanidylaniline;yttrium |
| SMILES | CC.[CH2-]Nc1[c-]cccc1.[Y] |
| InChI | InChI=1S/C7H7N.C2H6.Y/c1-8-7-5-3-2-4-6-7;1-2;/h2-5,8H,1H2;1-2H3;/q-2;; |
| InChIKey | PGILOVKHYLZJBQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methanidylaniline;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methanidylaniline;yttrium?
The IUPAC name of ethane;N-methanidylaniline;yttrium (CID 161273901) is ethane;N-methanidylaniline;yttrium.
What is the SMILES notation for ethane;N-methanidylaniline;yttrium?
The canonical SMILES for ethane;N-methanidylaniline;yttrium is CC.[CH2-]Nc1[c-]cccc1.[Y].
What is the InChIKey of ethane;N-methanidylaniline;yttrium?
The InChIKey is PGILOVKHYLZJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N.C2H6.Y/c1-8-7-5-3-2-4-6-7;1-2;/h2-5,8H,1H2;1-2H3;/q-2;;.
What are the key properties of ethane;N-methanidylaniline;yttrium?
ethane;N-methanidylaniline;yttrium has a molecular weight of 224.12 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methanidylaniline;yttrium is sourced from PubChem (CID 161273901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).