About calcium;bis(2-methylpropane);N-phenylcarbamate
calcium;bis(2-methylpropane);N-phenylcarbamate (PubChem CID 87412157) has the molecular formula C15H23CaNO2-2
and a molecular weight of 289.43 g/mol. Its IUPAC name is calcium;bis(2-methylpropane);N-phenylcarbamate.
Molecular Properties
| Compound Name | calcium;bis(2-methylpropane);N-phenylcarbamate |
| PubChem CID | 87412157 |
| Molecular Formula | C15H23CaNO2-2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | calcium;bis(2-methylpropane);N-phenylcarbamate |
| SMILES | C[C-](C)C.C[C-](C)C.O=C([O-])Nc1[c-]cccc1.[Ca+2] |
| InChI | InChI=1S/C7H6NO2.2C4H9.Ca/c9-7(10)8-6-4-2-1-3-5-6;2*1-4(2)3;/h1-4,8H,(H,9,10);2*1-3H3;/q3*-1;+2/p-1 |
| InChIKey | DYVPOVSXTMRCRC-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze calcium;bis(2-methylpropane);N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;bis(2-methylpropane);N-phenylcarbamate?
The IUPAC name of calcium;bis(2-methylpropane);N-phenylcarbamate (CID 87412157) is calcium;bis(2-methylpropane);N-phenylcarbamate.
What is the SMILES notation for calcium;bis(2-methylpropane);N-phenylcarbamate?
The canonical SMILES for calcium;bis(2-methylpropane);N-phenylcarbamate is C[C-](C)C.C[C-](C)C.O=C([O-])Nc1[c-]cccc1.[Ca+2].
What is the InChIKey of calcium;bis(2-methylpropane);N-phenylcarbamate?
The InChIKey is DYVPOVSXTMRCRC-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6NO2.2C4H9.Ca/c9-7(10)8-6-4-2-1-3-5-6;2*1-4(2)3;/h1-4,8H,(H,9,10);2*1-3H3;/q3*-1;+2/p-1.
What are the key properties of calcium;bis(2-methylpropane);N-phenylcarbamate?
calcium;bis(2-methylpropane);N-phenylcarbamate has a molecular weight of 289.43 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;bis(2-methylpropane);N-phenylcarbamate is sourced from PubChem (CID 87412157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).