C14H19NO3SW — CID 20660188
2-methylpropane;(E)-N-methylsulfonyl-3-phenylprop-2-enamide;tungsten(2+) (PubChem CID 20660188) has the molecular formula C14H19NO3SW and a molecular weight of 465.22 g/mol. Its IUPAC name is 2-methylpropane;(E)-N-methylsulfonyl-3-phenylprop-2-enamide;tungsten(2+).
| Compound Name | 2-methylpropane;(E)-N-methylsulfonyl-3-phenylprop-2-enamide;tungsten(2+) |
|---|---|
| PubChem CID | 20660188 |
| Molecular Formula | C14H19NO3SW |
| Molecular Weight | 465.22 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 2-methylpropane;(E)-N-methylsulfonyl-3-phenylprop-2-enamide;tungsten(2+) |
| SMILES | CS(=O)(=O)NC(=O)/C=C/c1[c-]cccc1.C[C-](C)C.[W+2] |
| InChI | InChI=1S/C10H10NO3S.C4H9.W/c1-15(13,14)11-10(12)8-7-9-5-3-2-4-6-9;1-4(2)3;/h2-5,7-8H,1H3,(H,11,12);1-3H3;/q2*-1;+2/b8-7+;; |
| InChIKey | WNYXRASVJHAPAT-MIIBGCIDSA-N |
| XLogP | 2.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|