C19H34N2O3S — CID 90947230
(E)-3-[2-[tert-butyl(methyl)amino]phenyl]-N-methylsulfonylprop-2-enamide;ethane (PubChem CID 90947230) has the molecular formula C19H34N2O3S and a molecular weight of 370.56 g/mol. Its IUPAC name is (E)-3-[2-[tert-butyl(methyl)amino]phenyl]-N-methylsulfonylprop-2-enamide;ethane.
| Compound Name | (E)-3-[2-[tert-butyl(methyl)amino]phenyl]-N-methylsulfonylprop-2-enamide;ethane |
|---|---|
| PubChem CID | 90947230 |
| Molecular Formula | C19H34N2O3S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (E)-3-[2-[tert-butyl(methyl)amino]phenyl]-N-methylsulfonylprop-2-enamide;ethane |
| SMILES | CC.CC.CN(c1ccccc1/C=C/C(=O)NS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C15H22N2O3S.2C2H6/c1-15(2,3)17(4)13-9-7-6-8-12(13)10-11-14(18)16-21(5,19)20;2*1-2/h6-11H,1-5H3,(H,16,18);2*1-2H3/b11-10+;; |
| InChIKey | HNMVFLMQLOOIBC-BGNBUWATSA-N |
| XLogP | 4.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|