3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride

C11H12ClNO — CID 57361561

IUPAC3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride
SMILESCN(C)c1ccccc1C=CC(=O)Cl
InChIInChI=1S/C11H12ClNO/c1-13(2)10-6-4-3-5-9(10)7-8-11(12)14/h3-8H,1-2H3
InChIKeyJXVODAJIUPDVFV-UHFFFAOYSA-N
MW209.68 g/mol
LogP2.53
Rot. Bonds3

About 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride

3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride (PubChem CID 57361561) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride.

Molecular Properties

Compound Name3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride
PubChem CID57361561
Molecular FormulaC11H12ClNO
Molecular Weight209.68 g/mol
Exact Mass209.06
IUPAC Name3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride
SMILESCN(C)c1ccccc1C=CC(=O)Cl
InChIInChI=1S/C11H12ClNO/c1-13(2)10-6-4-3-5-9(10)7-8-11(12)14/h3-8H,1-2H3
InChIKeyJXVODAJIUPDVFV-UHFFFAOYSA-N
XLogP2.53
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.68
LogP ≤ 52.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride?
The IUPAC name of 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride (CID 57361561) is 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride.
What is the SMILES notation for 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride?
The canonical SMILES for 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride is CN(C)c1ccccc1C=CC(=O)Cl.
What is the InChIKey of 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride?
The InChIKey is JXVODAJIUPDVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO/c1-13(2)10-6-4-3-5-9(10)7-8-11(12)14/h3-8H,1-2H3.
What are the key properties of 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride?
3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride has a molecular weight of 209.68 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(dimethylamino)phenyl]prop-2-enoyl chloride is sourced from PubChem (CID 57361561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).