C20H19NO2 — CID 141130646
2-[(E)-3-[2-(dimethylamino)phenyl]prop-2-enoyl]-2,3-dihydroinden-1-one (PubChem CID 141130646) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[(E)-3-[2-(dimethylamino)phenyl]prop-2-enoyl]-2,3-dihydroinden-1-one.
| Compound Name | 2-[(E)-3-[2-(dimethylamino)phenyl]prop-2-enoyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 141130646 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[(E)-3-[2-(dimethylamino)phenyl]prop-2-enoyl]-2,3-dihydroinden-1-one |
| SMILES | CN(C)c1ccccc1/C=C/C(=O)C1Cc2ccccc2C1=O |
| InChI | InChI=1S/C20H19NO2/c1-21(2)18-10-6-4-7-14(18)11-12-19(22)17-13-15-8-3-5-9-16(15)20(17)23/h3-12,17H,13H2,1-2H3/b12-11+ |
| InChIKey | XZMYYOBUKQCAFL-VAWYXSNFSA-N |
| XLogP | 3.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|