C28H32O4 — CID 11293406
tert-butyl (3Z)-3-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-1-phenylbut-2-enylidene]-1,2-dihydroindene-2-carboxylate (PubChem CID 11293406) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is tert-butyl (3Z)-3-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-1-phenylbut-2-enylidene]-1,2-dihydroindene-2-carboxylate.
| Compound Name | tert-butyl (3Z)-3-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-1-phenylbut-2-enylidene]-1,2-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 11293406 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | tert-butyl (3Z)-3-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-1-phenylbut-2-enylidene]-1,2-dihydroindene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)/C=C/C(=C1/c2ccccc2CC1C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H32O4/c1-27(2,3)31-24(29)17-16-22(19-12-8-7-9-13-19)25-21-15-11-10-14-20(21)18-23(25)26(30)32-28(4,5)6/h7-17,23H,18H2,1-6H3/b17-16+,25-22+ |
| InChIKey | XTQOKTHHWDPYRO-AFDOQIGGSA-N |
| XLogP | 6.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|