C22H21NO2 — CID 102526620
N-benzyl-3-oxo-N-penta-3,4-dienyl-1,2-dihydroindene-2-carboxamide (PubChem CID 102526620) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-benzyl-3-oxo-N-penta-3,4-dienyl-1,2-dihydroindene-2-carboxamide.
| Compound Name | N-benzyl-3-oxo-N-penta-3,4-dienyl-1,2-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 102526620 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-benzyl-3-oxo-N-penta-3,4-dienyl-1,2-dihydroindene-2-carboxamide |
| SMILES | C=C=CCCN(Cc1ccccc1)C(=O)C1Cc2ccccc2C1=O |
| InChI | InChI=1S/C22H21NO2/c1-2-3-9-14-23(16-17-10-5-4-6-11-17)22(25)20-15-18-12-7-8-13-19(18)21(20)24/h3-8,10-13,20H,1,9,14-16H2 |
| InChIKey | HPCXKMNGHHERIF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|