About 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium)
3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium) (PubChem CID 140645971) has the molecular formula C18H13NOY3-4
and a molecular weight of 526.03 g/mol. Its IUPAC name is 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium).
Molecular Properties
| Compound Name | 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium) |
| PubChem CID | 140645971 |
| Molecular Formula | C18H13NOY3-4 |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.82 |
| IUPAC Name | 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium) |
| SMILES | C/[C-]=C/c1[c-]ccc(NC(=O)/[C-]=C/c2[c-]cccc2)c1.[Y].[Y].[Y] |
| InChI | InChI=1S/C18H13NO.3Y/c1-2-7-16-10-6-11-17(14-16)19-18(20)13-12-15-8-4-3-5-9-15;;;/h3-8,11-12,14H,1H3,(H,19,20);;;/q-4;;; |
| InChIKey | DGZUJLJCGOYDPB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium)?
The IUPAC name of 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium) (CID 140645971) is 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium).
What is the SMILES notation for 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium)?
The canonical SMILES for 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium) is C/[C-]=C/c1[c-]ccc(NC(=O)/[C-]=C/c2[c-]cccc2)c1.[Y].[Y].[Y].
What is the InChIKey of 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium)?
The InChIKey is DGZUJLJCGOYDPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO.3Y/c1-2-7-16-10-6-11-17(14-16)19-18(20)13-12-15-8-4-3-5-9-15;;;/h3-8,11-12,14H,1H3,(H,19,20);;;/q-4;;;.
What are the key properties of 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium)?
3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium) has a molecular weight of 526.03 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-N-(3-prop-1-enylbenzene-4-id-1-yl)prop-2-enamide;tris(yttrium) is sourced from PubChem (CID 140645971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).